CAS 116702-65-9 is the registry number for 3-Amino-2-(4-methylphenylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-amino-2-(4-methylanilino)benzoic acid (CAS 116702-65-9) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 3-amino-2-(4-methylanilino)benzoic acid. InChIKey: GTTBSDNXVFGONG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 3-amino-2-(4-methylanilino)benzoic acid |
| InChIKey | GTTBSDNXVFGONG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=CC=C2N)C(=O)O |
Computed by PubChem (NCBI)