Products 1167055-90-4
CAS 1167055-90-4 is the registry number for 2-(Ethoxycarbonyl)-5-fluoro-1H-indole-7-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxycarbonyl-5-fluoro-1H-indole-7-carboxylic acid (CAS 1167055-90-4) is a chemical compound with the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. IUPAC name: 2-ethoxycarbonyl-5-fluoro-1H-indole-7-carboxylic acid. InChIKey: KCHYQDXDCAMAPD-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO4 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 2-ethoxycarbonyl-5-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | KCHYQDXDCAMAPD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2N1)C(=O)O)F |
Computed by PubChem (NCBI)