Products 932780-86-4

CAS 932780-86-4 is the registry number for Methyl 5-(2-fluorophenoxymethyl)-1,2-oxazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylate (CAS 932780-86-4) is a chemical compound with the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. IUPAC name: methyl 5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylate. InChIKey: HEZIENLYSUIDEM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10FNO4
Molecular weight251.21 g/mol
IUPAC namemethyl 5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylate
InChIKeyHEZIENLYSUIDEM-UHFFFAOYSA-N
SMILESCOC(=O)C1=NOC(=C1)COC2=CC=CC=C2F

Computed by PubChem (NCBI)