CAS 934063-54-4 appears in our catalog under these names: 4-[(3-Fluorophenoxy)methyl]-5-methylisoxazole-3-carboxylic acid, 95%, 4-((3-Fluorophenoxy)methyl)-5-methylisoxazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-[(3-fluorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid (CAS 934063-54-4) is a chemical compound with the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. IUPAC name: 4-[(3-fluorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: NMHQPJCBOQTBGN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO4 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 4-[(3-fluorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | NMHQPJCBOQTBGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)COC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)