CAS 923819-89-0 is the registry number for 5-Ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 923819-89-0) is a chemical compound with the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. IUPAC name: 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: SCVRIWPTORCFOF-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO4 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | SCVRIWPTORCFOF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(N=C(O1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)