Products 138592-92-4
CAS 138592-92-4 is the registry number for (4-Fluoro-phenyl)-acetic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 2-(4-fluorophenyl)acetate (CAS 138592-92-4) is a chemical compound with the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(4-fluorophenyl)acetate. InChIKey: UQSNSYMTPUITMN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO4 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-(4-fluorophenyl)acetate |
| InChIKey | UQSNSYMTPUITMN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)