CAS 1167056-53-2 appears in our catalog under these names: 4–Bromo–5,7–dimethyl–1H–indole, 4-Bromo-5,7-dimethyl-1H-indole 95%, 4-Bromo-5,7-dimethyl-1H-indole, 95%, 95%, 4-Bromo-5,7-dimethyl-1H-indole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-5,7-dimethyl-1H-indole (CAS 1167056-53-2) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 4-bromo-5,7-dimethyl-1H-indole. InChIKey: WLPYFCJCFLFZKO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 4-bromo-5,7-dimethyl-1H-indole |
| InChIKey | WLPYFCJCFLFZKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC=C2)Br)C |
Computed by PubChem (NCBI)