CAS 116724-79-9 is the registry number for O1-tert-butyl O2,O5-dimethyl cis-pyrrolidine-1,2,5-tricarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 2-O,5-O-dimethyl (2R,5S)-pyrrolidine-1,2,5-tricarboxylate (CAS 116724-79-9) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O,5-O-dimethyl (2R,5S)-pyrrolidine-1,2,5-tricarboxylate. InChIKey: IBFGGAQUXJGPAC-DTORHVGOSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O,5-O-dimethyl (2R,5S)-pyrrolidine-1,2,5-tricarboxylate |
| InChIKey | IBFGGAQUXJGPAC-DTORHVGOSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CC[C@H]1C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)