Products 1422343-95-0
CAS 1422343-95-0 appears in our catalog under these names: 1,4-Oxazepine-4,7(5H)-dicarboxylic acid, tetrahydro-6-oxo-, 4-(1,1-dimethylethyl) 7-ethyl ester, >95%, >95%, 4-tert-Butyl 7-ethyl 6-oxo-1,4-oxazepane-4,7-dicarboxylate, 95%, 4-tert-Butyl 7-ethyl 6-oxo-1,4-oxazepane-4,7-dicarboxylate, 95+%, 4-Tert-Butyl 7-Ethyl 6-Oxo-1,4-Oxazepane-4,7-Dicarboxylate. Offered by: Chemat, Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-O-tert-butyl 7-O-ethyl 6-oxo-1,4-oxazepane-4,7-dicarboxylate (CAS 1422343-95-0) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 4-O-tert-butyl 7-O-ethyl 6-oxo-1,4-oxazepane-4,7-dicarboxylate. InChIKey: KPLRWEADFOJTOD-UHFFFAOYSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 4-O-tert-butyl 7-O-ethyl 6-oxo-1,4-oxazepane-4,7-dicarboxylate |
| InChIKey | KPLRWEADFOJTOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)CN(CCO1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)