CAS 1330763-23-9 appears in our catalog under these names: 6-Oxo-[1,4]oxazepane-4,5-dicarboxylic acid 4-tert-butyl ester 5-ethyl ester, 95%, 4–tert–Butyl 5–ethyl 6–oxo–1,4–oxazepane–4,5–dicarboxylate, 4-tert-Butyl 5-ethyl 6-oxo-1,4-oxazepane-4,5-dicarboxylate, >95%, >95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-O-tert-butyl 5-O-ethyl 6-oxo-1,4-oxazepane-4,5-dicarboxylate (CAS 1330763-23-9) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 4-O-tert-butyl 5-O-ethyl 6-oxo-1,4-oxazepane-4,5-dicarboxylate. InChIKey: CRMCVFCPWKMQAH-UHFFFAOYSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 4-O-tert-butyl 5-O-ethyl 6-oxo-1,4-oxazepane-4,5-dicarboxylate |
| InChIKey | CRMCVFCPWKMQAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)COCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)