Products 1623083-98-6
CAS 1623083-98-6 is the registry number for tert-Butyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)ethylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)ethyl]carbamate (CAS 1623083-98-6) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: tert-butyl N-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)ethyl]carbamate. InChIKey: WPTWNOUBUBIXBM-UHFFFAOYSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | tert-butyl N-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)ethyl]carbamate |
| InChIKey | WPTWNOUBUBIXBM-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CCNC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)