CAS 1212409-03-4 is the registry number for Cis-1-(tert-butoxycarbonyl)-4-(ethoxycarbonyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(3R,4S)-4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1212409-03-4) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: (3R,4S)-4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: BHOJIKSQYLVZHD-DTWKUNHWSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | (3R,4S)-4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | BHOJIKSQYLVZHD-DTWKUNHWSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)