Products 1169870-80-7
CAS 1169870-80-7 appears in our catalog under these names: 4–Chloro–2–fluoro–3–methoxybenzoic acid, 4-Chloro-2-fluoro-3-methoxybenzoic acid, 4-Chloro-2-fluoro-3-methoxybenzoic acid 95%, 4-Chloro-2-fluoro-3-methoxybenzoic acid, 95%, 95%, 4-Chloro-2-fluoro-3-methoxybenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-chloro-2-fluoro-3-methoxybenzoic acid (CAS 1169870-80-7) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 4-chloro-2-fluoro-3-methoxybenzoic acid. InChIKey: ODAJPJWSLSBLLM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 4-chloro-2-fluoro-3-methoxybenzoic acid |
| InChIKey | ODAJPJWSLSBLLM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)Cl |
Computed by PubChem (NCBI)