Products 1169882-37-4
CAS 1169882-37-4 is the registry number for 6-Methoxybenzo[e][1,2,3]oxathiazine 2,2-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 1169882-37-4) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 6-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: WVWXSJPYYRHPDH-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 6-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | WVWXSJPYYRHPDH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OS(=O)(=O)N=C2 |
Computed by PubChem (NCBI)