CAS 6375-65-1 appears in our catalog under these names: [(2-Nitrophenyl)thio]acetic acid, 95%, 2–((2–Nitrophenyl)thio)acetic acid, 2-((2-nitrophenyl)sulfanyl)acetic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 0,5g.
2-(2-nitrophenyl)sulfanylacetic acid (CAS 6375-65-1) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 2-(2-nitrophenyl)sulfanylacetic acid. InChIKey: PINPTHMYKLERLV-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 2-(2-nitrophenyl)sulfanylacetic acid |
| InChIKey | PINPTHMYKLERLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SCC(=O)O |
Computed by PubChem (NCBI)