Products 325704-15-2

CAS 325704-15-2 is the registry number for 2-[(Carboxymethyl)sulfanyl]nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

2-(carboxymethylsulfanyl)pyridine-3-carboxylic acid (CAS 325704-15-2) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 2-(carboxymethylsulfanyl)pyridine-3-carboxylic acid. InChIKey: LWYLTYOUJNZLKD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO4S
Molecular weight213.21 g/mol
IUPAC name2-(carboxymethylsulfanyl)pyridine-3-carboxylic acid
InChIKeyLWYLTYOUJNZLKD-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)SCC(=O)O)C(=O)O

Computed by PubChem (NCBI)