CAS 342623-49-8 appears in our catalog under these names: Benzo[d]isoxazol-3-ylmethanesulfonic acid, 98%, Zonisamide Related Compound A, Zonisamide Impurity 1 Acid. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,2-benzoxazol-3-ylmethanesulfonic acid (CAS 342623-49-8) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 1,2-benzoxazol-3-ylmethanesulfonic acid. InChIKey: BNWNQJBNOQDMHB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 1,2-benzoxazol-3-ylmethanesulfonic acid |
| InChIKey | BNWNQJBNOQDMHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)CS(=O)(=O)O |
Computed by PubChem (NCBI)