CAS 92115-37-2 appears in our catalog under these names: 1,2-Benzisothiazol-3(2h)-one,4-methoxy-,1,1-dioxide, 95%, 4-Methoxybenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%, 4-Methoxybenzo[d]isothiazol-3(2H)-one 1,1-dioxide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one (CAS 92115-37-2) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: IELNXGPPRWLPCZ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | IELNXGPPRWLPCZ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC=C1)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)