Products 64399-24-2
CAS 64399-24-2 appears in our catalog under these names: 4-(Methylthio)-3-nitrobenzoic acid, 95%, 4-(Methylthio)-3-nitrobenzoic acid, 97%, 4-(Methylthio)-3-nitrobenzoic acid 95%, 4-(Methylthio)-3-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-methylsulfanyl-3-nitrobenzoic acid (CAS 64399-24-2) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 4-methylsulfanyl-3-nitrobenzoic acid. InChIKey: BPZVSOOQLVSCDF-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 4-methylsulfanyl-3-nitrobenzoic acid |
| InChIKey | BPZVSOOQLVSCDF-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(Methylthio)-3-Nitrobenzoic Acid, 4-Methylthio-3-nitrobenzoic acid, 4-(Methylsulfanyl)-3-nitrobenzoic acid, 4-methylsulfanyl-3-nitrobenzoic acid, 3-Nitro-4-(methylthio)benzoic acid, Benzoic acid, 4-(methylthio)-3-nitro-, 4-Methylsulfanyl-3-nitro-benzoic acid, 4-(Methylsulfanyl)-3-nitrobenzoic acid #