Products 1170070-40-2

CAS 1170070-40-2 is the registry number for 1-((2,2,2-Trifluoroethoxy)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(2,2,2-trifluoroethoxymethyl)pyrazole-3-carboxylic acid (CAS 1170070-40-2) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 1-(2,2,2-trifluoroethoxymethyl)pyrazole-3-carboxylic acid. InChIKey: WLZRRVFBRBZUFK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O3
Molecular weight224.14 g/mol
IUPAC name1-(2,2,2-trifluoroethoxymethyl)pyrazole-3-carboxylic acid
InChIKeyWLZRRVFBRBZUFK-UHFFFAOYSA-N
SMILESC1=CN(N=C1C(=O)O)COCC(F)(F)F

Computed by PubChem (NCBI)