Products 2821786-31-4

CAS 2821786-31-4 is the registry number for 3-(Methoxymethyl)-1-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(methoxymethyl)-1-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 2821786-31-4) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 3-(methoxymethyl)-1-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: SYOGBIMTSKTNGR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O3
Molecular weight224.14 g/mol
IUPAC name3-(methoxymethyl)-1-(trifluoromethyl)pyrazole-5-carboxylic acid
InChIKeySYOGBIMTSKTNGR-UHFFFAOYSA-N
SMILESCOCC1=NN(C(=C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)