CAS 2111401-34-2 is the registry number for 5-(1,1,1-Trifluoro-2-methylpropan-2-yl)-1,2,4-oxadiazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2,4-oxadiazole-3-carboxylic acid (CAS 2111401-34-2) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2,4-oxadiazole-3-carboxylic acid. InChIKey: IZLRTKSTJBJCTJ-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O3 |
|---|---|
| Molecular weight | 224.14 g/mol |
| IUPAC name | 5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2,4-oxadiazole-3-carboxylic acid |
| InChIKey | IZLRTKSTJBJCTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC(=NO1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)