Products 1227002-41-6

CAS 1227002-41-6 is the registry number for 1-Methyl-3-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (CAS 1227002-41-6) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid. InChIKey: FMGOQXKOLOLYDP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O3
Molecular weight224.14 g/mol
IUPAC name1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid
InChIKeyFMGOQXKOLOLYDP-UHFFFAOYSA-N
SMILESCN1C(=CC(=N1)OCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)