Products 1493914-00-3

CAS 1493914-00-3 is the registry number for 1-(2-(Trifluoromethoxy)ethyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-[2-(trifluoromethoxy)ethyl]pyrazole-4-carboxylic acid (CAS 1493914-00-3) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 1-[2-(trifluoromethoxy)ethyl]pyrazole-4-carboxylic acid. InChIKey: DQGCGZJFDDBJFW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O3
Molecular weight224.14 g/mol
IUPAC name1-[2-(trifluoromethoxy)ethyl]pyrazole-4-carboxylic acid
InChIKeyDQGCGZJFDDBJFW-UHFFFAOYSA-N
SMILESC1=C(C=NN1CCOC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)