Products 117014-32-1
CAS 117014-32-1 appears in our catalog under these names: Boc-asp(ofm)-oh, 95%, Boc–Asp(Ofm)–OH, Boc-Asp(Ofm)-OH 97%, BOC-ASP(OFM)-OH, 98%, 98%, Boc-Asp(Ofm)-OH, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
(2S)-4-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 117014-32-1) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (2S)-4-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: NHLRMCFWGFPSLT-IBGZPJMESA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (2S)-4-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | NHLRMCFWGFPSLT-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)