CAS 218457-76-2 appears in our catalog under these names: Fmoc-L-2-aminosuberic acid, 97%, Fmoc-L-2-aminosuberic acid, 95+%, Fmoc-l-2-aminosuberic acid, 98%, 98%, Fmoc–L–alpha–aminosuberic acid, Fmoc-Asu-OH, 99%. Offered by: Combi-blocks, Fluorochem, Chemat, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanedioic acid (CAS 218457-76-2) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanedioic acid. InChIKey: IMAOCPQKEUWDNC-FQEVSTJZSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanedioic acid |
| InChIKey | IMAOCPQKEUWDNC-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)