CAS 129460-09-9 appears in our catalog under these names: Fmoc–Asp–OtBu, Fmoc-L-Asp-OtBu, N-Fmoc-L-aspartic acid 1-tert-butyl ester, 95% , Fmoc-Asp(OH)-OtBu, Fmoc-Asp(OtBu)-OH. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 50g, 250g, 1kg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 129460-09-9) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: VZXQYACYLGRQJU-IBGZPJMESA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | VZXQYACYLGRQJU-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)