Products 1966923-09-0

CAS 1966923-09-0 is the registry number for Fmoc-Leu-glycolic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxyacetic acid (CAS 1966923-09-0) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: 2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxyacetic acid. InChIKey: KKBSZKVZXQAIGV-FQEVSTJZSA-N.

Identity
Molecular formulaC23H25NO6
Molecular weight411.4 g/mol
IUPAC name2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxyacetic acid
InChIKeyKKBSZKVZXQAIGV-FQEVSTJZSA-N
SMILESCC(C)C[C@@H](C(=O)OCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)