CAS 71989-14-5 appears in our catalog under these names: Fmoc–Asp(OtBu)–OH, Fmoc-L-Asp(OtBu)-OH, N-Fmoc-L-aspartic acid 4-tert-butyl ester, 98% , Fmoc-Asp(OtBu)-OH, 99.00%, Fmoc-Asp(OtBu)-OH. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 100g, 500g, 25g, 250g, 5g, 10g, 1g, 50g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 71989-14-5) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: FODJWPHPWBKDON-UHFFFAOYSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | FODJWPHPWBKDON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)