Products 214630-04-3
CAS 214630-04-3 appears in our catalog under these names: Boc-D-Asp-OFm, Boc–D–Asp–OFm. Offered by: Creative Peptides, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 50g, 100g.
(3R)-4-(9H-fluoren-9-ylmethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 214630-04-3) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (3R)-4-(9H-fluoren-9-ylmethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: RMRKPGGMJKNMSK-LJQANCHMSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (3R)-4-(9H-fluoren-9-ylmethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | RMRKPGGMJKNMSK-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)