CAS 1170410-91-9 is the registry number for 2-Chloro-4-propylpyrido[2,3-b]pyrazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-propylpyrido[2,3-b]pyrazin-3-one (CAS 1170410-91-9) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 2-chloro-4-propylpyrido[2,3-b]pyrazin-3-one. InChIKey: KTVRZXYOFWVLIS-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 2-chloro-4-propylpyrido[2,3-b]pyrazin-3-one |
| InChIKey | KTVRZXYOFWVLIS-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=CC=N2)N=C(C1=O)Cl |
Computed by PubChem (NCBI)