Products 1170419-33-6
CAS 1170419-33-6 appears in our catalog under these names: 2',4'-Dimethylbiphenyl-3-carboxylic acid, 98%, 2',4'-Dimethylbiphenyl-3-carboxylic acid 98%, 2',4'-Dimethylbiphenyl-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(2,4-dimethylphenyl)benzoic acid (CAS 1170419-33-6) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)benzoic acid. InChIKey: UMORCGAQBRIKAF-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)benzoic acid |
| InChIKey | UMORCGAQBRIKAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)