Products 1170433-81-4
CAS 1170433-81-4 is the registry number for 3-(Pyridin-2-ylmethoxy)aniline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-(pyridin-2-ylmethoxy)aniline;dihydrochloride (CAS 1170433-81-4) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: 3-(pyridin-2-ylmethoxy)aniline;dihydrochloride. InChIKey: ZHIZQYWETCRYPT-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | 3-(pyridin-2-ylmethoxy)aniline;dihydrochloride |
| InChIKey | ZHIZQYWETCRYPT-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=CC=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)