CAS 1240569-52-1 is the registry number for (3,4-Dichlorophenyl)(2-methylpiperazin-1-yl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone (CAS 1240569-52-1) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: (3,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone. InChIKey: YWLCRESFGSOMRL-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone |
| InChIKey | YWLCRESFGSOMRL-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)