CAS 1240577-19-8 is the registry number for (2,4-Dichlorophenyl)(2-methylpiperazin-1-yl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone (CAS 1240577-19-8) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: (2,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone. InChIKey: AKJXQMCDSIZPHF-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-(2-methylpiperazin-1-yl)methanone |
| InChIKey | AKJXQMCDSIZPHF-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)