CAS 1779125-33-5 appears in our catalog under these names: 5-Chlorospiro[indoline-3,4'-piperidin]-2-one hydrochloride, 95%, 5-Chlorospiro(indoline-3,4'-piperidin)-2-one hydrochloride, 95%, 5–Chloro–1,2–dihydrospiro(indole–3,4'–piperidine)–2–one hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
5-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CAS 1779125-33-5) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: 5-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride. InChIKey: DWFJUZLOYQCERM-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | 5-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | DWFJUZLOYQCERM-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)Cl)NC2=O.Cl |
Computed by PubChem (NCBI)