Products 2034621-68-4
CAS 2034621-68-4 appears in our catalog under these names: 1-(4-(Pyridin-2-yloxy)phenyl)methanamine dihydrochloride, 1-[4-(Pyridin-2-yloxy)phenyl]methanamine dihydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 100mg, 1g, 250mg.
(4-pyridin-2-yloxyphenyl)methanamine;dihydrochloride (CAS 2034621-68-4) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: (4-pyridin-2-yloxyphenyl)methanamine;dihydrochloride. InChIKey: OPNHCJBXPLOHNN-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | (4-pyridin-2-yloxyphenyl)methanamine;dihydrochloride |
| InChIKey | OPNHCJBXPLOHNN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC2=CC=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)