CAS 117054-79-2 is the registry number for 7-Nitrobenzo[d]isothiazol-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-nitro-1,2-benzothiazol-3-one (CAS 117054-79-2) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 7-nitro-1,2-benzothiazol-3-one. InChIKey: LHYONJUQUSYTNE-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 7-nitro-1,2-benzothiazol-3-one |
| InChIKey | LHYONJUQUSYTNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])SNC2=O |
Computed by PubChem (NCBI)