CAS 933759-69-4 appears in our catalog under these names: 5-(2-Thiazolyl)isoxazole-3-carboxylic acid, 95%, 5–(2–Thiazolyl)isoxazole–3–carboxylic Acid, 5-(Thiazol-2-yl)isoxazole-3-carboxylic acid, 97%, 97%, 5-(Thiazol-2-yl)isoxazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylic acid (CAS 933759-69-4) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: GJYQCDMPWRJWNG-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GJYQCDMPWRJWNG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)