Products 2091528-06-0

CAS 2091528-06-0 is the registry number for 5-(1,2-Thiazol-5-yl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid (CAS 2091528-06-0) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: XTIUUDVNPJRLDU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4N2O3S
Molecular weight196.19 g/mol
IUPAC name5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid
InChIKeyXTIUUDVNPJRLDU-UHFFFAOYSA-N
SMILESC1=C(SN=C1)C2=CC(=NO2)C(=O)O

Computed by PubChem (NCBI)