CAS 2091528-06-0 is the registry number for 5-(1,2-Thiazol-5-yl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid (CAS 2091528-06-0) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: XTIUUDVNPJRLDU-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 5-(1,2-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | XTIUUDVNPJRLDU-UHFFFAOYSA-N |
| SMILES | C1=C(SN=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)