CAS 51991-94-7 is the registry number for 5-Oxo-5h-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g, 10g.
5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid (CAS 51991-94-7) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid. InChIKey: FDGPDTWORUVKQX-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid |
| InChIKey | FDGPDTWORUVKQX-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=O)N21)C(=O)O |
Computed by PubChem (NCBI)