CAS 1216288-05-9 is the registry number for 4-Oxo-3H,4H-thieno[2,3-d]pyrimidine-5-carboxylic Acid. Offered by: Chemat. Available pack sizes: 1g.
4-oxo-3H-thieno[2,3-d]pyrimidine-5-carboxylic acid (CAS 1216288-05-9) is a chemical compound with the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. IUPAC name: 4-oxo-3H-thieno[2,3-d]pyrimidine-5-carboxylic acid. InChIKey: OJNWNTNUJCAOSU-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 4-oxo-3H-thieno[2,3-d]pyrimidine-5-carboxylic acid |
| InChIKey | OJNWNTNUJCAOSU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)N=CNC2=O)C(=O)O |
Computed by PubChem (NCBI)