CAS 1171575-96-4 appears in our catalog under these names: 5-((3,4-Dimethylphenyl)methyl)-1,3-thiazol-2-amine hydrochloride, 95%, 5-((3,4-Dimethylphenyl)methyl)-1,3-thiazol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride (CAS 1171575-96-4) is a chemical compound with the molecular formula C12H15ClN2S and a molecular weight of 254.78 g/mol. IUPAC name: 5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride. InChIKey: RCBIOJDQJKACMM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2S |
|---|---|
| Molecular weight | 254.78 g/mol |
| IUPAC name | 5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | RCBIOJDQJKACMM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC2=CN=C(S2)N)C.Cl |
Computed by PubChem (NCBI)