CAS 1432754-23-8 is the registry number for N-Methyl-1-(3-(2-methylthiazol-4-yl)phenyl)methanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
N-methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;hydrochloride (CAS 1432754-23-8) is a chemical compound with the molecular formula C12H15ClN2S and a molecular weight of 254.78 g/mol. IUPAC name: N-methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;hydrochloride. InChIKey: XOHTXGMKPPQVRD-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2S |
|---|---|
| Molecular weight | 254.78 g/mol |
| IUPAC name | N-methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;hydrochloride |
| InChIKey | XOHTXGMKPPQVRD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=CC(=C2)CNC.Cl |
Computed by PubChem (NCBI)