CAS 1948273-01-5 appears in our catalog under these names: (S)–1–(4–(4Methylthiazol–5–yl)phenyl)ethan–1–amine HCl, (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(4-(4-METHYLTHIAZOL-5-YL)PHENYL)ETHAN-1-AMINE HCL, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g.
(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;hydrochloride (CAS 1948273-01-5) is a chemical compound with the molecular formula C12H15ClN2S and a molecular weight of 254.78 g/mol. IUPAC name: (1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;hydrochloride. InChIKey: CIJVVVNRJVUMNI-QRPNPIFTSA-N.
| Molecular formula | C12H15ClN2S |
|---|---|
| Molecular weight | 254.78 g/mol |
| IUPAC name | (1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;hydrochloride |
| InChIKey | CIJVVVNRJVUMNI-QRPNPIFTSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)N.Cl |
Computed by PubChem (NCBI)