CAS 913614-18-3 appears in our catalog under these names: 1-(1-Benzothiophen-4-yl)piperazine hydrochloride, 97%, 1-Benzo(b)thien-4-yl-piperazine Monohydrochloride, 1-Benzo(b)thien-4-yl-piperazine Hydrochloride, 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride 97%, 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride, 98%, 98%. Offered by: Combi-blocks, TRC, Mikromol, Ambeed, Chemat. Available pack sizes: 10g, 25g, 100g, 1g, 5g, 250mg, 4x25mg, 25mg.
1-(1-benzothiophen-4-yl)piperazine;hydrochloride (CAS 913614-18-3) is a chemical compound with the molecular formula C12H15ClN2S and a molecular weight of 254.78 g/mol. IUPAC name: 1-(1-benzothiophen-4-yl)piperazine;hydrochloride. InChIKey: XDUUWPNOUUQXBX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2S |
|---|---|
| Molecular weight | 254.78 g/mol |
| IUPAC name | 1-(1-benzothiophen-4-yl)piperazine;hydrochloride |
| InChIKey | XDUUWPNOUUQXBX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CSC3=CC=C2.Cl |
Computed by PubChem (NCBI)