CAS 1197519-74-6 appears in our catalog under these names: 1-(4-Methyl-2-phenyl-1,3-thiazol-5-yl)ethan-1-amine hydrochloride, 95%, 1-(4-Methyl-2-phenyl-1,3-thiazol-5-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanamine;hydrochloride (CAS 1197519-74-6) is a chemical compound with the molecular formula C12H15ClN2S and a molecular weight of 254.78 g/mol. IUPAC name: 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanamine;hydrochloride. InChIKey: FOMDKZPHORNVLX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2S |
|---|---|
| Molecular weight | 254.78 g/mol |
| IUPAC name | 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanamine;hydrochloride |
| InChIKey | FOMDKZPHORNVLX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)C(C)N.Cl |
Computed by PubChem (NCBI)