CAS 1171612-59-1 appears in our catalog under these names: 1-(3-Bromo-4-methoxyphenyl)ethan-1-amine hydrochloride, 1-(3-Bromo-4-methoxyphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
1-(3-bromo-4-methoxyphenyl)ethanamine;hydrochloride (CAS 1171612-59-1) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)ethanamine;hydrochloride. InChIKey: HWDQDOJCFVFAQC-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | HWDQDOJCFVFAQC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)Br)N.Cl |
Computed by PubChem (NCBI)