CAS 1171709-53-7 is the registry number for 1-Methyl-5-nitro-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-methyl-5-nitropyrazole-3-carboxylic acid (CAS 1171709-53-7) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 1-methyl-5-nitropyrazole-3-carboxylic acid. InChIKey: LANAGXKGLVPPDP-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 1-methyl-5-nitropyrazole-3-carboxylic acid |
| InChIKey | LANAGXKGLVPPDP-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)