Products 72648-46-5
CAS 72648-46-5 appears in our catalog under these names: Exemestane EP Impurity F, 6-Oxo Boldione, >95% (HPLC), Androsta-1,4-diene-3,6,17-trione, 6-Oxo boldione. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 100mg, 2,5mg, 25mg, 5mg, 10mg, 50mg.
(8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,6,17-trione (CAS 72648-46-5) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,6,17-trione. InChIKey: BXPQXTJWPDQYMP-IEVKOWOJSA-N.
| Molecular formula | C19H22O3 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,6,17-trione |
| InChIKey | BXPQXTJWPDQYMP-IEVKOWOJSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=O)C4=CC(=O)C=C[C@]34C |
Computed by PubChem (NCBI)